C19H21N3O5S — CID 58574059
ethyl 4-[4-(dimethylsulfamoyl)phenoxy]-2-methylindazole-6-carboxylate (PubChem CID 58574059) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is ethyl 4-[4-(dimethylsulfamoyl)phenoxy]-2-methylindazole-6-carboxylate.
| Compound Name | ethyl 4-[4-(dimethylsulfamoyl)phenoxy]-2-methylindazole-6-carboxylate |
|---|---|
| PubChem CID | 58574059 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl 4-[4-(dimethylsulfamoyl)phenoxy]-2-methylindazole-6-carboxylate |
| SMILES | CCOC(=O)c1cc(Oc2ccc(S(=O)(=O)N(C)C)cc2)c2cn(C)nc2c1 |
| InChI | InChI=1S/C19H21N3O5S/c1-5-26-19(23)13-10-17-16(12-22(4)20-17)18(11-13)27-14-6-8-15(9-7-14)28(24,25)21(2)3/h6-12H,5H2,1-4H3 |
| InChIKey | MWWIVOMSAZIMFP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |