C19H18O7S — CID 88587430
ethyl 2-formyl-4-(4-methylsulfonylphenoxy)-2,3-dihydro-1-benzofuran-6-carboxylate (PubChem CID 88587430) has the molecular formula C19H18O7S and a molecular weight of 390.41 g/mol. Its IUPAC name is ethyl 2-formyl-4-(4-methylsulfonylphenoxy)-2,3-dihydro-1-benzofuran-6-carboxylate.
| Compound Name | ethyl 2-formyl-4-(4-methylsulfonylphenoxy)-2,3-dihydro-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 88587430 |
| Molecular Formula | C19H18O7S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | ethyl 2-formyl-4-(4-methylsulfonylphenoxy)-2,3-dihydro-1-benzofuran-6-carboxylate |
| SMILES | CCOC(=O)c1cc(Oc2ccc(S(C)(=O)=O)cc2)c2c(c1)OC(C=O)C2 |
| InChI | InChI=1S/C19H18O7S/c1-3-24-19(21)12-8-17(16-10-14(11-20)26-18(16)9-12)25-13-4-6-15(7-5-13)27(2,22)23/h4-9,11,14H,3,10H2,1-2H3 |
| InChIKey | YBBHEYXOWREZMP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|