C14H22ClN3O2 — CID 156881522
tert-butyl N-[1-(4-chloropyrazol-1-yl)-4-methylpent-4-en-2-yl]carbamate (PubChem CID 156881522) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chloropyrazol-1-yl)-4-methylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-chloropyrazol-1-yl)-4-methylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 156881522 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl N-[1-(4-chloropyrazol-1-yl)-4-methylpent-4-en-2-yl]carbamate |
| SMILES | C=C(C)CC(Cn1cc(Cl)cn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22ClN3O2/c1-10(2)6-12(9-18-8-11(15)7-16-18)17-13(19)20-14(3,4)5/h7-8,12H,1,6,9H2,2-5H3,(H,17,19) |
| InChIKey | XAVUKVMKIWXDPL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|