C36H48N8O6 — CID 156882807
4-(4-aminophenyl)-N-[4-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]-3-oxopropoxy]propylamino]cyclohexyl]piperazine-1-carboxamide (PubChem CID 156882807) has the molecular formula C36H48N8O6 and a molecular weight of 688.83 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[4-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]-3-oxopropoxy]propylamino]cyclohexyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-aminophenyl)-N-[4-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]-3-oxopropoxy]propylamino]cyclohexyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 156882807 |
| Molecular Formula | C36H48N8O6 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | 4-(4-aminophenyl)-N-[4-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]-3-oxopropoxy]propylamino]cyclohexyl]piperazine-1-carboxamide |
| SMILES | Nc1ccc(N2CCN(C(=O)NC3CCC(NCCCOCCC(=O)Nc4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C36H48N8O6/c37-25-2-9-29(10-3-25)42-16-18-43(19-17-42)36(49)40-27-6-4-26(5-7-27)38-15-1-20-50-21-14-33(46)39-28-8-11-30-24(22-28)23-44(35(30)48)31-12-13-32(45)41-34(31)47/h2-3,8-11,22,26-27,31,38H,1,4-7,12-21,23,37H2,(H,39,46)(H,40,49)(H,41,45,47) |
| InChIKey | GFRFYQFUVSNCRZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|