C30H37N7O7 — CID 174041531
3-[2-[2-[2-[[2-(4-aminophenyl)-2-hydrazinylideneethylidene]amino]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide (PubChem CID 174041531) has the molecular formula C30H37N7O7 and a molecular weight of 607.67 g/mol. Its IUPAC name is 3-[2-[2-[2-[[2-(4-aminophenyl)-2-hydrazinylideneethylidene]amino]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide.
| Compound Name | 3-[2-[2-[2-[[2-(4-aminophenyl)-2-hydrazinylideneethylidene]amino]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide |
|---|---|
| PubChem CID | 174041531 |
| Molecular Formula | C30H37N7O7 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 3-[2-[2-[2-[[2-(4-aminophenyl)-2-hydrazinylideneethylidene]amino]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide |
| SMILES | NN=C(/C=N/CCOCCOCCOCCC(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H37N7O7/c31-22-3-1-20(2-4-22)25(36-32)18-33-10-12-43-14-16-44-15-13-42-11-9-28(39)34-23-5-6-24-21(17-23)19-37(30(24)41)26-7-8-27(38)35-29(26)40/h1-6,17-18,26H,7-16,19,31-32H2,(H,34,39)(H,35,38,40)/b33-18+,36-25? |
| InChIKey | ZZFUMDRUCOGWJZ-YRCHRLFDSA-N |
| XLogP | 0.84 |
| TPSA | 200.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|