C24H31N7O4 — CID 178000549
3-[1-[[amino-[[(E)-pent-2-en-2-yl]amino]methylidene]amino]ethylideneamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide (PubChem CID 178000549) has the molecular formula C24H31N7O4 and a molecular weight of 481.56 g/mol. Its IUPAC name is 3-[1-[[amino-[[(E)-pent-2-en-2-yl]amino]methylidene]amino]ethylideneamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide.
| Compound Name | 3-[1-[[amino-[[(E)-pent-2-en-2-yl]amino]methylidene]amino]ethylideneamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide |
|---|---|
| PubChem CID | 178000549 |
| Molecular Formula | C24H31N7O4 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 3-[1-[[amino-[[(E)-pent-2-en-2-yl]amino]methylidene]amino]ethylideneamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]propanamide |
| SMILES | CC/C=C(\C)N/C(N)=N/C(C)=N/CCC(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H31N7O4/c1-4-5-14(2)27-24(25)28-15(3)26-11-10-21(33)29-17-6-7-18-16(12-17)13-31(23(18)35)19-8-9-20(32)30-22(19)34/h5-7,12,19H,4,8-11,13H2,1-3H3,(H,29,33)(H,30,32,34)(H3,25,26,27,28)/b14-5+ |
| InChIKey | STDNMMXQSPDWOK-LHHJGKSTSA-N |
| XLogP | 1.41 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|