C19H30N4O7 — CID 156882898
2-[2-[2-(3-amino-2-hydroxypropoxy)ethoxy]ethoxy]-N-[3-[[formamido(methyl)amino]methyl]-4-formylphenyl]acetamide (PubChem CID 156882898) has the molecular formula C19H30N4O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[2-[2-(3-amino-2-hydroxypropoxy)ethoxy]ethoxy]-N-[3-[[formamido(methyl)amino]methyl]-4-formylphenyl]acetamide.
| Compound Name | 2-[2-[2-(3-amino-2-hydroxypropoxy)ethoxy]ethoxy]-N-[3-[[formamido(methyl)amino]methyl]-4-formylphenyl]acetamide |
|---|---|
| PubChem CID | 156882898 |
| Molecular Formula | C19H30N4O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[2-[2-(3-amino-2-hydroxypropoxy)ethoxy]ethoxy]-N-[3-[[formamido(methyl)amino]methyl]-4-formylphenyl]acetamide |
| SMILES | CN(Cc1cc(NC(=O)COCCOCCOCC(O)CN)ccc1C=O)NC=O |
| InChI | InChI=1S/C19H30N4O7/c1-23(21-14-25)10-16-8-17(3-2-15(16)11-24)22-19(27)13-30-7-5-28-4-6-29-12-18(26)9-20/h2-3,8,11,14,18,26H,4-7,9-10,12-13,20H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | HZBZZQLICNFROY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|