C25H40N2O7 — CID 156883099
N-formyl-4-[[2-formyl-5-[2-[2-[2-(2-hydroxybutoxy)ethoxy]ethoxy]ethyl]phenyl]methyl-methylamino]pentanamide (PubChem CID 156883099) has the molecular formula C25H40N2O7 and a molecular weight of 480.60 g/mol. Its IUPAC name is N-formyl-4-[[2-formyl-5-[2-[2-[2-(2-hydroxybutoxy)ethoxy]ethoxy]ethyl]phenyl]methyl-methylamino]pentanamide.
| Compound Name | N-formyl-4-[[2-formyl-5-[2-[2-[2-(2-hydroxybutoxy)ethoxy]ethoxy]ethyl]phenyl]methyl-methylamino]pentanamide |
|---|---|
| PubChem CID | 156883099 |
| Molecular Formula | C25H40N2O7 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-formyl-4-[[2-formyl-5-[2-[2-[2-(2-hydroxybutoxy)ethoxy]ethoxy]ethyl]phenyl]methyl-methylamino]pentanamide |
| SMILES | CCC(O)COCCOCCOCCc1ccc(C=O)c(CN(C)C(C)CCC(=O)NC=O)c1 |
| InChI | InChI=1S/C25H40N2O7/c1-4-24(30)18-34-14-13-33-12-11-32-10-9-21-6-7-22(17-28)23(15-21)16-27(3)20(2)5-8-25(31)26-19-29/h6-7,15,17,19-20,24,30H,4-5,8-14,16,18H2,1-3H3,(H,26,29,31) |
| InChIKey | GVXAUQNDYJCHTK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|