C23H33N2O5Si — CID 156883803
CID 156883803 (PubChem CID 156883803) has the molecular formula C23H33N2O5Si and a molecular weight of 445.61 g/mol.
| Compound Name | CID 156883803 |
|---|---|
| PubChem CID | 156883803 |
| Molecular Formula | C23H33N2O5Si |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | — |
| SMILES | COC(=O)[Si](CCC(=O)N1CCOc2ccccc2C1)NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C23H33N2O5Si/c1-29-23(28)31(24-21(26)12-11-18-7-3-2-4-8-18)16-13-22(27)25-14-15-30-20-10-6-5-9-19(20)17-25/h5-6,9-10,18H,2-4,7-8,11-17H2,1H3,(H,24,26) |
| InChIKey | JKGCCAHUEWCDGB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|