C23H32N2O4 — CID 166756401
3-cyclohexyl-N-[(2S)-5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-1,5-dioxopentan-2-yl]propanamide (PubChem CID 166756401) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2S)-5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-1,5-dioxopentan-2-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[(2S)-5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-1,5-dioxopentan-2-yl]propanamide |
|---|---|
| PubChem CID | 166756401 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-cyclohexyl-N-[(2S)-5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-1,5-dioxopentan-2-yl]propanamide |
| SMILES | O=C[C@H](CCC(=O)N1CCOc2ccccc2C1)NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C23H32N2O4/c26-17-20(24-22(27)12-10-18-6-2-1-3-7-18)11-13-23(28)25-14-15-29-21-9-5-4-8-19(21)16-25/h4-5,8-9,17-18,20H,1-3,6-7,10-16H2,(H,24,27)/t20-/m0/s1 |
| InChIKey | FWUDTRPJJLMDDJ-FQEVSTJZSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|