C32H46N4O6S — CID 156884489
methyl 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]sulfanylpropanoyl]amino]-3-(2-hydroxy-1-azaspiro[4.5]decan-3-yl)propanoate (PubChem CID 156884489) has the molecular formula C32H46N4O6S and a molecular weight of 614.81 g/mol. Its IUPAC name is methyl 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]sulfanylpropanoyl]amino]-3-(2-hydroxy-1-azaspiro[4.5]decan-3-yl)propanoate.
| Compound Name | methyl 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]sulfanylpropanoyl]amino]-3-(2-hydroxy-1-azaspiro[4.5]decan-3-yl)propanoate |
|---|---|
| PubChem CID | 156884489 |
| Molecular Formula | C32H46N4O6S |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | methyl 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]sulfanylpropanoyl]amino]-3-(2-hydroxy-1-azaspiro[4.5]decan-3-yl)propanoate |
| SMILES | COC(=O)C(CC1CC2(CCCCC2)NC1O)NC(=O)[C@H](CC1CCCCC1)SNC(=O)c1cc2c(OC)cccc2[nH]1 |
| InChI | InChI=1S/C32H46N4O6S/c1-41-26-13-9-12-23-22(26)18-24(33-23)29(38)36-43-27(16-20-10-5-3-6-11-20)30(39)34-25(31(40)42-2)17-21-19-32(35-28(21)37)14-7-4-8-15-32/h9,12-13,18,20-21,25,27-28,33,35,37H,3-8,10-11,14-17,19H2,1-2H3,(H,34,39)(H,36,38)/t21?,25?,27-,28?/m0/s1 |
| InChIKey | WFSRHMFHKIEZLJ-XZAWYBICSA-N |
| XLogP | 4.57 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|