C32H44N4O6 — CID 168861047
2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-2-methyl-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propanoic acid (PubChem CID 168861047) has the molecular formula C32H44N4O6 and a molecular weight of 580.73 g/mol. Its IUPAC name is 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-2-methyl-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propanoic acid.
| Compound Name | 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-2-methyl-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propanoic acid |
|---|---|
| PubChem CID | 168861047 |
| Molecular Formula | C32H44N4O6 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2-[[(2S)-3-cyclohexyl-2-[(4-methoxy-1H-indole-2-carbonyl)amino]propanoyl]amino]-2-methyl-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propanoic acid |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@@H](CC3CCCCC3)C(=O)NC(C)(CC3CC4(CCCCC4)NC3=O)C(=O)O)cc12 |
| InChI | InChI=1S/C32H44N4O6/c1-31(30(40)41,18-21-19-32(36-27(21)37)14-7-4-8-15-32)35-29(39)24(16-20-10-5-3-6-11-20)34-28(38)25-17-22-23(33-25)12-9-13-26(22)42-2/h9,12-13,17,20-21,24,33H,3-8,10-11,14-16,18-19H2,1-2H3,(H,34,38)(H,35,39)(H,36,37)(H,40,41)/t21?,24-,31?/m0/s1 |
| InChIKey | WVGKWTDJHPBDCY-UYXPAWESSA-N |
| XLogP | 4.43 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |