C14H34N2O — CID 156884797
N'-(4-ethoxybutyl)-N'-ethyl-N-propan-2-ylpropane-1,3-diamine;molecular hydrogen (PubChem CID 156884797) has the molecular formula C14H34N2O and a molecular weight of 246.44 g/mol. Its IUPAC name is N'-(4-ethoxybutyl)-N'-ethyl-N-propan-2-ylpropane-1,3-diamine;molecular hydrogen.
| Compound Name | N'-(4-ethoxybutyl)-N'-ethyl-N-propan-2-ylpropane-1,3-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 156884797 |
| Molecular Formula | C14H34N2O |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.27 |
| IUPAC Name | N'-(4-ethoxybutyl)-N'-ethyl-N-propan-2-ylpropane-1,3-diamine;molecular hydrogen |
| SMILES | CCOCCCCN(CC)CCCNC(C)C.[H][H] |
| InChI | InChI=1S/C14H32N2O.H2/c1-5-16(11-7-8-13-17-6-2)12-9-10-15-14(3)4;/h14-15H,5-13H2,1-4H3;1H |
| InChIKey | HHFUPWIRQONBDG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|