C25H30N6O — CID 156887697
2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)phenol (PubChem CID 156887697) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)phenol.
| Compound Name | 2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)phenol |
|---|---|
| PubChem CID | 156887697 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-(8-ethyl-2-methylimidazo[1,2-a]pyridin-6-yl)phenol |
| SMILES | C=C/C(=N\N=C(/C)N1CCNCC1)c1ccc(-c2cc(CC)c3nc(C)cn3c2)cc1O |
| InChI | InChI=1S/C25H30N6O/c1-5-19-13-21(16-31-15-17(3)27-25(19)31)20-7-8-22(24(32)14-20)23(6-2)29-28-18(4)30-11-9-26-10-12-30/h6-8,13-16,26,32H,2,5,9-12H2,1,3-4H3/b28-18+,29-23+ |
| InChIKey | MKNPZAGMJXSJSE-GWYVRFCQSA-N |
| XLogP | 3.79 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|