C25H31N5O — CID 156887646
2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-[(3Z)-3-ethylidene-5-methyl-4-methyliminocyclohexa-1,5-dien-1-yl]phenol (PubChem CID 156887646) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-[(3Z)-3-ethylidene-5-methyl-4-methyliminocyclohexa-1,5-dien-1-yl]phenol.
| Compound Name | 2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-[(3Z)-3-ethylidene-5-methyl-4-methyliminocyclohexa-1,5-dien-1-yl]phenol |
|---|---|
| PubChem CID | 156887646 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-[(E)-C-ethenyl-N-[(E)-1-piperazin-1-ylethylideneamino]carbonimidoyl]-5-[(3Z)-3-ethylidene-5-methyl-4-methyliminocyclohexa-1,5-dien-1-yl]phenol |
| SMILES | C=C/C(=N\N=C(/C)N1CCNCC1)c1ccc(C2=CC(=C/C)/C(=N/C)C(C)=C2)cc1O |
| InChI | InChI=1S/C25H31N5O/c1-6-19-15-21(14-17(3)25(19)26-5)20-8-9-22(24(31)16-20)23(7-2)29-28-18(4)30-12-10-27-11-13-30/h6-9,14-16,27,31H,2,10-13H2,1,3-5H3/b19-6-,26-25+,28-18+,29-23+ |
| InChIKey | YZCCJGMOJURKFS-NGMHQCJZSA-N |
| XLogP | 3.97 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|