C21H25FN6 — CID 156887824
(E)-N-[(E)-1-(4,7-diazaspiro[2.5]octan-7-yl)ethylideneamino]-1-[4-(5-fluoro-1H-pyrazol-4-yl)-2-methylphenyl]prop-2-en-1-imine (PubChem CID 156887824) has the molecular formula C21H25FN6 and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-N-[(E)-1-(4,7-diazaspiro[2.5]octan-7-yl)ethylideneamino]-1-[4-(5-fluoro-1H-pyrazol-4-yl)-2-methylphenyl]prop-2-en-1-imine.
| Compound Name | (E)-N-[(E)-1-(4,7-diazaspiro[2.5]octan-7-yl)ethylideneamino]-1-[4-(5-fluoro-1H-pyrazol-4-yl)-2-methylphenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 156887824 |
| Molecular Formula | C21H25FN6 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (E)-N-[(E)-1-(4,7-diazaspiro[2.5]octan-7-yl)ethylideneamino]-1-[4-(5-fluoro-1H-pyrazol-4-yl)-2-methylphenyl]prop-2-en-1-imine |
| SMILES | C=C/C(=N\N=C(/C)N1CCNC2(CC2)C1)c1ccc(-c2cn[nH]c2F)cc1C |
| InChI | InChI=1S/C21H25FN6/c1-4-19(26-25-15(3)28-10-9-23-21(13-28)7-8-21)17-6-5-16(11-14(17)2)18-12-24-27-20(18)22/h4-6,11-12,23H,1,7-10,13H2,2-3H3,(H,24,27)/b25-15+,26-19+ |
| InChIKey | UNFCMRXEEAOGMR-COUBIZMASA-N |
| XLogP | 3.27 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|