C21H22BN5O — CID 156889081
2-amino-4-(1-cyanoborinan-4-yl)-N-(2-methylindazol-5-yl)benzamide (PubChem CID 156889081) has the molecular formula C21H22BN5O and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-amino-4-(1-cyanoborinan-4-yl)-N-(2-methylindazol-5-yl)benzamide.
| Compound Name | 2-amino-4-(1-cyanoborinan-4-yl)-N-(2-methylindazol-5-yl)benzamide |
|---|---|
| PubChem CID | 156889081 |
| Molecular Formula | C21H22BN5O |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-amino-4-(1-cyanoborinan-4-yl)-N-(2-methylindazol-5-yl)benzamide |
| SMILES | Cn1cc2cc(NC(=O)c3ccc(C4CCB(C#N)CC4)cc3N)ccc2n1 |
| InChI | InChI=1S/C21H22BN5O/c1-27-12-16-10-17(3-5-20(16)26-27)25-21(28)18-4-2-15(11-19(18)24)14-6-8-22(13-23)9-7-14/h2-5,10-12,14H,6-9,24H2,1H3,(H,25,28) |
| InChIKey | ZSSGIQBKHRYPEJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|