C23H18O7 — CID 156891832
[2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] 4-methoxybenzoate (PubChem CID 156891832) has the molecular formula C23H18O7 and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] 4-methoxybenzoate.
| Compound Name | [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 156891832 |
| Molecular Formula | C23H18O7 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-5-hydroxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cc(O)ccc2C(=O)/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C23H18O7/c1-29-17-7-4-15(5-8-17)23(28)30-22-13-16(24)6-9-18(22)19(25)10-2-14-3-11-20(26)21(27)12-14/h2-13,24,26-27H,1H3/b10-2+ |
| InChIKey | PYGHWUOJNXKNPH-WTDSWWLTSA-N |
| XLogP | 3.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|