C9H16N4 — CID 156892661
ethane;2-(1H-pyrazol-4-ylmethylamino)propanenitrile (PubChem CID 156892661) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is ethane;2-(1H-pyrazol-4-ylmethylamino)propanenitrile.
| Compound Name | ethane;2-(1H-pyrazol-4-ylmethylamino)propanenitrile |
|---|---|
| PubChem CID | 156892661 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | ethane;2-(1H-pyrazol-4-ylmethylamino)propanenitrile |
| SMILES | CC.CC(C#N)NCc1cn[nH]c1 |
| InChI | InChI=1S/C7H10N4.C2H6/c1-6(2-8)9-3-7-4-10-11-5-7;1-2/h4-6,9H,3H2,1H3,(H,10,11);1-2H3 |
| InChIKey | NZHKXOHYHAZVJL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |