C30H38ClF2N5O3 — CID 156893484
N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-oxoethyl]-1-cyano-4-hydroxypyrrolidine-2-carboxamide;4,4-difluoro-N-methylcyclohexan-1-amine (PubChem CID 156893484) has the molecular formula C30H38ClF2N5O3 and a molecular weight of 590.12 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-oxoethyl]-1-cyano-4-hydroxypyrrolidine-2-carboxamide;4,4-difluoro-N-methylcyclohexan-1-amine.
| Compound Name | N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-oxoethyl]-1-cyano-4-hydroxypyrrolidine-2-carboxamide;4,4-difluoro-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 156893484 |
| Molecular Formula | C30H38ClF2N5O3 |
| Molecular Weight | 590.12 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-oxoethyl]-1-cyano-4-hydroxypyrrolidine-2-carboxamide;4,4-difluoro-N-methylcyclohexan-1-amine |
| SMILES | CC(C)(C)c1ccc(N(C(=O)C2CC(O)CN2C#N)C(C=O)c2cncc(Cl)c2)cc1.CNC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C23H25ClN4O3.C7H13F2N/c1-23(2,3)16-4-6-18(7-5-16)28(21(13-29)15-8-17(24)11-26-10-15)22(31)20-9-19(30)12-27(20)14-25;1-10-6-2-4-7(8,9)5-3-6/h4-8,10-11,13,19-21,30H,9,12H2,1-3H3;6,10H,2-5H2,1H3 |
| InChIKey | FZXXAUYBOLDARD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.12 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|