C29H34F3N5O3 — CID 156894421
(2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(2-fluoro-3-pyridinyl)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 156894421) has the molecular formula C29H34F3N5O3 and a molecular weight of 557.62 g/mol. Its IUPAC name is (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(2-fluoro-3-pyridinyl)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(2-fluoro-3-pyridinyl)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156894421 |
| Molecular Formula | C29H34F3N5O3 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(2-fluoro-3-pyridinyl)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)[C@H]2C[C@@H](O)CN2C#N)C(C(=O)NC2CCC(F)(F)CC2)c2cccnc2F)cc1 |
| InChI | InChI=1S/C29H34F3N5O3/c1-28(2,3)18-6-8-20(9-7-18)37(27(40)23-15-21(38)16-36(23)17-33)24(22-5-4-14-34-25(22)30)26(39)35-19-10-12-29(31,32)13-11-19/h4-9,14,19,21,23-24,38H,10-13,15-16H2,1-3H3,(H,35,39)/t21-,23-,24?/m1/s1 |
| InChIKey | XINIAEXRXLRGQD-UMBAGBCYSA-N |
| XLogP | 4.20 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|