C33H39N5O4 — CID 166040759
N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-(2-oxo-1H-quinolin-4-yl)ethyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 166040759) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-(2-oxo-1H-quinolin-4-yl)ethyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-(2-oxo-1H-quinolin-4-yl)ethyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166040759 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-(2-oxo-1H-quinolin-4-yl)ethyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)C2CC(O)CN2C#N)C(C(=O)NC2CCCCC2)c2cc(=O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C33H39N5O4/c1-33(2,3)21-13-15-23(16-14-21)38(32(42)28-17-24(39)19-37(28)20-34)30(31(41)35-22-9-5-4-6-10-22)26-18-29(40)36-27-12-8-7-11-25(26)27/h7-8,11-16,18,22,24,28,30,39H,4-6,9-10,17,19H2,1-3H3,(H,35,41)(H,36,40) |
| InChIKey | OXMQFSYJNACNBA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|