C33H39N5O3 — CID 166040428
(2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-1-isoquinolin-4-yl-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 166040428) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-1-isoquinolin-4-yl-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-1-isoquinolin-4-yl-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166040428 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-1-isoquinolin-4-yl-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)[C@H]2C[C@@H](O)CN2C#N)C(C(=O)NC2CCCCC2)c2cncc3ccccc23)cc1 |
| InChI | InChI=1S/C33H39N5O3/c1-33(2,3)23-13-15-25(16-14-23)38(32(41)29-17-26(39)20-37(29)21-34)30(31(40)36-24-10-5-4-6-11-24)28-19-35-18-22-9-7-8-12-27(22)28/h7-9,12-16,18-19,24,26,29-30,39H,4-6,10-11,17,20H2,1-3H3,(H,36,40)/t26-,29-,30?/m1/s1 |
| InChIKey | QGSZFHHCKVGRFK-LSIZHKAQSA-N |
| XLogP | 4.97 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|