C31H38F5N5O3 — CID 156892529
2-(4-tert-butyl-N-methylanilino)-N-(4,4-difluorocyclohexyl)-2-[5-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile (PubChem CID 156892529) has the molecular formula C31H38F5N5O3 and a molecular weight of 623.67 g/mol. Its IUPAC name is 2-(4-tert-butyl-N-methylanilino)-N-(4,4-difluorocyclohexyl)-2-[5-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile.
| Compound Name | 2-(4-tert-butyl-N-methylanilino)-N-(4,4-difluorocyclohexyl)-2-[5-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156892529 |
| Molecular Formula | C31H38F5N5O3 |
| Molecular Weight | 623.67 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 2-(4-tert-butyl-N-methylanilino)-N-(4,4-difluorocyclohexyl)-2-[5-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
| SMILES | CN(c1ccc(C(C)(C)C)cc1)C(C(=O)NC1CCC(F)(F)CC1)c1cncc(C(F)(F)F)c1.N#CN1CC(O)CC1C=O |
| InChI | InChI=1S/C25H30F5N3O.C6H8N2O2/c1-23(2,3)17-5-7-20(8-6-17)33(4)21(16-13-18(15-31-14-16)25(28,29)30)22(34)32-19-9-11-24(26,27)12-10-19;7-4-8-2-6(10)1-5(8)3-9/h5-8,13-15,19,21H,9-12H2,1-4H3,(H,32,34);3,5-6,10H,1-2H2 |
| InChIKey | AERUTYATYOKULF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|