C29H33F3N6O3 — CID 156893541
N-(4,4-difluorocyclohexyl)-2-(5-fluoro-3-pyridinyl)-2-[methyl-(3-methyl-1H-indol-6-yl)amino]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile (PubChem CID 156893541) has the molecular formula C29H33F3N6O3 and a molecular weight of 570.62 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(5-fluoro-3-pyridinyl)-2-[methyl-(3-methyl-1H-indol-6-yl)amino]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(5-fluoro-3-pyridinyl)-2-[methyl-(3-methyl-1H-indol-6-yl)amino]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156893541 |
| Molecular Formula | C29H33F3N6O3 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(5-fluoro-3-pyridinyl)-2-[methyl-(3-methyl-1H-indol-6-yl)amino]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
| SMILES | Cc1c[nH]c2cc(N(C)C(C(=O)NC3CCC(F)(F)CC3)c3cncc(F)c3)ccc12.N#CN1CC(O)CC1C=O |
| InChI | InChI=1S/C23H25F3N4O.C6H8N2O2/c1-14-11-28-20-10-18(3-4-19(14)20)30(2)21(15-9-16(24)13-27-12-15)22(31)29-17-5-7-23(25,26)8-6-17;7-4-8-2-6(10)1-5(8)3-9/h3-4,9-13,17,21,28H,5-8H2,1-2H3,(H,29,31);3,5-6,10H,1-2H2 |
| InChIKey | HXWJWCJYXPMBOW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|