C27H32F3N5O3 — CID 156893121
N-cyclohexyl-2-(N-methylanilino)-2-[4-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile (PubChem CID 156893121) has the molecular formula C27H32F3N5O3 and a molecular weight of 531.58 g/mol. Its IUPAC name is N-cyclohexyl-2-(N-methylanilino)-2-[4-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile.
| Compound Name | N-cyclohexyl-2-(N-methylanilino)-2-[4-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156893121 |
| Molecular Formula | C27H32F3N5O3 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-cyclohexyl-2-(N-methylanilino)-2-[4-(trifluoromethyl)-3-pyridinyl]acetamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
| SMILES | CN(c1ccccc1)C(C(=O)NC1CCCCC1)c1cnccc1C(F)(F)F.N#CN1CC(O)CC1C=O |
| InChI | InChI=1S/C21H24F3N3O.C6H8N2O2/c1-27(16-10-6-3-7-11-16)19(20(28)26-15-8-4-2-5-9-15)17-14-25-13-12-18(17)21(22,23)24;7-4-8-2-6(10)1-5(8)3-9/h3,6-7,10-15,19H,2,4-5,8-9H2,1H3,(H,26,28);3,5-6,10H,1-2H2 |
| InChIKey | SRIDWVIDJGCONL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|