C12H24N2O3 — CID 15689538
tert-butyl 2-[(2-amino-2-methylpropanoyl)amino]-2-methylpropanoate (PubChem CID 15689538) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is tert-butyl 2-[(2-amino-2-methylpropanoyl)amino]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[(2-amino-2-methylpropanoyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 15689538 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | tert-butyl 2-[(2-amino-2-methylpropanoyl)amino]-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)NC(=O)C(C)(C)N |
| InChI | InChI=1S/C12H24N2O3/c1-10(2,3)17-9(16)12(6,7)14-8(15)11(4,5)13/h13H2,1-7H3,(H,14,15) |
| InChIKey | ZAEZKGGGRJFKFA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |