C9H18N2O3 — CID 57038729
tert-butyl (2S)-2-amino-2-methyl-3-(methylamino)-3-oxopropanoate (PubChem CID 57038729) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-2-methyl-3-(methylamino)-3-oxopropanoate.
| Compound Name | tert-butyl (2S)-2-amino-2-methyl-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 57038729 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | tert-butyl (2S)-2-amino-2-methyl-3-(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)[C@](C)(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O3/c1-8(2,3)14-7(13)9(4,10)6(12)11-5/h10H2,1-5H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | HQTVWQUSDJJQEW-VIFPVBQESA-N |
| XLogP | -0.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|