C19H22N2O5S — CID 156900837
4-[(2,4-dioxo-5-prop-2-enyl-1,3-thiazolidin-3-yl)methyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 156900837) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-[(2,4-dioxo-5-prop-2-enyl-1,3-thiazolidin-3-yl)methyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[(2,4-dioxo-5-prop-2-enyl-1,3-thiazolidin-3-yl)methyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 156900837 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[(2,4-dioxo-5-prop-2-enyl-1,3-thiazolidin-3-yl)methyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | C=CCC1SC(=O)N(Cc2ccc(C(=O)NOC3CCCCO3)cc2)C1=O |
| InChI | InChI=1S/C19H22N2O5S/c1-2-5-15-18(23)21(19(24)27-15)12-13-7-9-14(10-8-13)17(22)20-26-16-6-3-4-11-25-16/h2,7-10,15-16H,1,3-6,11-12H2,(H,20,22) |
| InChIKey | WFPJGGAEWJDPBI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|