C29H24ClN3O — CID 156906489
2-[3-chloro-5-[methyl(naphthalen-1-ylmethyl)amino]phenyl]-N-isoquinolin-4-ylacetamide (PubChem CID 156906489) has the molecular formula C29H24ClN3O and a molecular weight of 465.98 g/mol. Its IUPAC name is 2-[3-chloro-5-[methyl(naphthalen-1-ylmethyl)amino]phenyl]-N-isoquinolin-4-ylacetamide.
| Compound Name | 2-[3-chloro-5-[methyl(naphthalen-1-ylmethyl)amino]phenyl]-N-isoquinolin-4-ylacetamide |
|---|---|
| PubChem CID | 156906489 |
| Molecular Formula | C29H24ClN3O |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[3-chloro-5-[methyl(naphthalen-1-ylmethyl)amino]phenyl]-N-isoquinolin-4-ylacetamide |
| SMILES | CN(Cc1cccc2ccccc12)c1cc(Cl)cc(CC(=O)Nc2cncc3ccccc23)c1 |
| InChI | InChI=1S/C29H24ClN3O/c1-33(19-23-10-6-9-21-7-2-4-11-26(21)23)25-14-20(13-24(30)16-25)15-29(34)32-28-18-31-17-22-8-3-5-12-27(22)28/h2-14,16-18H,15,19H2,1H3,(H,32,34) |
| InChIKey | QWAHTESKWRFBSB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |