C16H11Cl2N3O — CID 156906657
2-(3,4-dichlorophenyl)-N-(2,7-naphthyridin-4-yl)acetamide (PubChem CID 156906657) has the molecular formula C16H11Cl2N3O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(2,7-naphthyridin-4-yl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(2,7-naphthyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 156906657 |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(2,7-naphthyridin-4-yl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)Nc1cncc2cnccc12 |
| InChI | InChI=1S/C16H11Cl2N3O/c17-13-2-1-10(5-14(13)18)6-16(22)21-15-9-20-8-11-7-19-4-3-12(11)15/h1-5,7-9H,6H2,(H,21,22) |
| InChIKey | IOZNTHKFTJIBSE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |