C17H15ClN4O3 — CID 156907141
N-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-4-oxo-4aH-phthalazine-1-carboxamide (PubChem CID 156907141) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is N-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-4-oxo-4aH-phthalazine-1-carboxamide.
| Compound Name | N-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-4-oxo-4aH-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 156907141 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-4-oxo-4aH-phthalazine-1-carboxamide |
| SMILES | Cc1cc(C(=O)CCl)c(C)n1NC(=O)C1=C2C=CC=CC2C(=O)N=N1 |
| InChI | InChI=1S/C17H15ClN4O3/c1-9-7-13(14(23)8-18)10(2)22(9)21-17(25)15-11-5-3-4-6-12(11)16(24)20-19-15/h3-7,12H,8H2,1-2H3,(H,21,25) |
| InChIKey | SKAJAQGECBOUNJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|