C20H22N4O5S — CID 15693166
9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(4-methylphenyl)sulfanyl-3H-purin-2-one (PubChem CID 15693166) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(4-methylphenyl)sulfanyl-3H-purin-2-one.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(4-methylphenyl)sulfanyl-3H-purin-2-one |
|---|---|
| PubChem CID | 15693166 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(4-methylphenyl)sulfanyl-3H-purin-2-one |
| SMILES | Cc1ccc(Sc2nc(=O)[nH]c3c2ncn3[C@@H]2O[C@H](CO)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C20H22N4O5S/c1-10-4-6-11(7-5-10)30-17-13-16(22-19(26)23-17)24(9-21-13)18-15-14(12(8-25)27-18)28-20(2,3)29-15/h4-7,9,12,14-15,18,25H,8H2,1-3H3,(H,22,23,26)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | PYMGHVLSNSAKDS-SCFUHWHPSA-N |
| XLogP | 1.99 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |