C20H24INO3 — CID 15694680
(6aS)-2,11-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol iodide (PubChem CID 15694680) has the molecular formula C20H24INO3 and a molecular weight of 453.32 g/mol. Its IUPAC name is (6aS)-2,11-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol iodide.
| Compound Name | (6aS)-2,11-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol iodide |
|---|---|
| PubChem CID | 15694680 |
| Molecular Formula | C20H24INO3 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (6aS)-2,11-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol iodide |
| SMILES | COc1cc2c3c(c1O)-c1c(cccc1OC)C[C@@H]3[N+](C)(C)CC2.[I-] |
| InChI | InChI=1S/C20H23NO3.HI/c1-21(2)9-8-13-11-16(24-4)20(22)19-17(13)14(21)10-12-6-5-7-15(23-3)18(12)19;/h5-7,11,14H,8-10H2,1-4H3;1H/t14-;/m0./s1 |
| InChIKey | QLBUWVBNKDHOEL-UQKRIMTDSA-N |
| XLogP | 0.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|