C17H17N3O — CID 15695424
(3S,5R)-3,5-diphenyl-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine (PubChem CID 15695424) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (3S,5R)-3,5-diphenyl-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine.
| Compound Name | (3S,5R)-3,5-diphenyl-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 15695424 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3S,5R)-3,5-diphenyl-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine |
| SMILES | c1ccc([C@@H]2NCCC3=NO[C@@H](c4ccccc4)N32)cc1 |
| InChI | InChI=1S/C17H17N3O/c1-3-7-13(8-4-1)16-18-12-11-15-19-21-17(20(15)16)14-9-5-2-6-10-14/h1-10,16-18H,11-12H2/t16-,17+/m1/s1 |
| InChIKey | FRHMYJBQSLEZEC-SJORKVTESA-N |
| XLogP | 3.02 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |