C41H72NO10P — CID 156965120
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate (PubChem CID 156965120) has the molecular formula C41H72NO10P and a molecular weight of 770.00 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate |
|---|---|
| PubChem CID | 156965120 |
| Molecular Formula | C41H72NO10P |
| Molecular Weight | 770.00 g/mol |
| Exact Mass | 769.49 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCC[C@H](O)[C@@H](O)C/C=C\CCCCC |
| InChI | InChI=1S/C41H72NO10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-23-27-31-40(45)49-35-37(36-51-53(47,48)50-34-33-42)52-41(46)32-28-24-20-22-26-30-39(44)38(43)29-25-21-10-8-6-4-2/h5,7,11-12,14-15,17-18,21,25,37-39,43-44H,3-4,6,8-10,13,16,19-20,22-24,26-36,42H2,1-2H3,(H,47,48)/b7-5-,12-11-,15-14-,18-17-,25-21-/t37-,38+,39+/m1/s1 |
| InChIKey | VSARSHSJRLIGOZ-UFRWBLBHSA-N |
| XLogP | 8.88 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.00 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|