C45H78NO10P — CID 156987640
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 156987640) has the molecular formula C45H78NO10P and a molecular weight of 824.09 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 156987640 |
| Molecular Formula | C45H78NO10P |
| Molecular Weight | 824.09 g/mol |
| Exact Mass | 823.54 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCC[C@H](O)[C@@H](O)C/C=C\CCCCC |
| InChI | InChI=1S/C45H78NO10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-27-31-35-44(49)53-39-41(40-55-57(51,52)54-38-37-46)56-45(50)36-32-28-24-26-30-34-43(48)42(47)33-29-25-10-8-6-4-2/h5,7,11-12,14-15,17-18,20-21,25,29,41-43,47-48H,3-4,6,8-10,13,16,19,22-24,26-28,30-40,46H2,1-2H3,(H,51,52)/b7-5-,12-11-,15-14-,18-17-,21-20-,29-25-/t41-,42+,43+/m1/s1 |
| InChIKey | HARDJIJMTVJHRC-DELQMVRLSA-N |
| XLogP | 10.21 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.09 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|