C43H76NO10P — CID 156965745
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 156965745) has the molecular formula C43H76NO10P and a molecular weight of 798.05 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156965745 |
| Molecular Formula | C43H76NO10P |
| Molecular Weight | 798.05 g/mol |
| Exact Mass | 797.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCC[C@@H](O)[C@H](O)C/C=C\CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H76NO10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-25-30-34-43(48)54-39(38-53-55(49,50)52-36-35-44)37-51-42(47)33-29-26-22-24-28-32-41(46)40(45)31-27-23-10-8-6-4-2/h11-12,14-15,17-18,20-21,23,27,39-41,45-46H,3-10,13,16,19,22,24-26,28-38,44H2,1-2H3,(H,49,50)/b12-11-,15-14-,18-17-,21-20-,27-23-/t39-,40-,41-/m1/s1 |
| InChIKey | LQRIHWWSNLBXFI-BQUKTCRNSA-N |
| XLogP | 9.66 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.05 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|