C33H57O10P — CID 156966032
[(2R)-2-decanoyloxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate (PubChem CID 156966032) has the molecular formula C33H57O10P and a molecular weight of 644.78 g/mol. Its IUPAC name is [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate.
| Compound Name | [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156966032 |
| Molecular Formula | C33H57O10P |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.37 |
| IUPAC Name | [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H57O10P/c1-3-5-7-9-11-13-19-25-33(37)43-31(28-42-44(38,39)40)27-41-32(36)26-20-24-30(35)23-18-15-14-17-22-29(34)21-16-12-10-8-6-4-2/h12,14-18,22-23,29-31,34-35H,3-11,13,19-21,24-28H2,1-2H3,(H2,38,39,40)/b15-14+,16-12-,22-17+,23-18-/t29-,30-,31-/m1/s1 |
| InChIKey | ZSORKEKEBXMMGD-OCYDASOLSA-N |
| XLogP | 6.78 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|