C41H67O10P — CID 156967486
[(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate (PubChem CID 156967486) has the molecular formula C41H67O10P and a molecular weight of 750.95 g/mol. Its IUPAC name is [(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate.
| Compound Name | [(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156967486 |
| Molecular Formula | C41H67O10P |
| Molecular Weight | 750.95 g/mol |
| Exact Mass | 750.45 |
| IUPAC Name | [(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H67O10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-27-33-41(45)51-39(36-50-52(46,47)48)35-49-40(44)34-28-32-38(43)31-26-23-22-25-30-37(42)29-24-20-10-8-6-4-2/h11-12,14-15,17-18,20,22-26,30-31,37-39,42-43H,3-10,13,16,19,21,27-29,32-36H2,1-2H3,(H2,46,47,48)/b12-11-,15-14-,18-17-,23-22+,24-20-,30-25+,31-26-/t37-,38-,39-/m1/s1 |
| InChIKey | VYZQZAGAVKIUPV-IKOCWANOSA-N |
| XLogP | 9.23 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.95 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|