C36H63O10P — CID 156970183
[(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl] (5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate (PubChem CID 156970183) has the molecular formula C36H63O10P and a molecular weight of 686.86 g/mol. Its IUPAC name is [(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl] (5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate.
| Compound Name | [(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl] (5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156970183 |
| Molecular Formula | C36H63O10P |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.42 |
| IUPAC Name | [(2R)-1-(10-methyldodecanoyloxy)-3-phosphonooxypropan-2-yl] (5R,6Z,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C/C=C\[C@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)O |
| InChI | InChI=1S/C36H63O10P/c1-4-6-7-8-12-17-23-32(37)24-18-14-15-19-25-33(38)26-21-28-36(40)46-34(30-45-47(41,42)43)29-44-35(39)27-20-13-10-9-11-16-22-31(3)5-2/h12,14-15,17-19,24-25,31-34,37-38H,4-11,13,16,20-23,26-30H2,1-3H3,(H2,41,42,43)/b15-14+,17-12-,24-18+,25-19-/t31?,32-,33-,34+/m0/s1 |
| InChIKey | CLJVJBAMULUCCQ-UFBFEMNSSA-N |
| XLogP | 7.80 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|