C41H67O9P — CID 156967451
[(2R)-3-phosphonooxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 156967451) has the molecular formula C41H67O9P and a molecular weight of 734.95 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | [(2R)-3-phosphonooxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 156967451 |
| Molecular Formula | C41H67O9P |
| Molecular Weight | 734.95 g/mol |
| Exact Mass | 734.45 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCC1OC1C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H67O9P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-33-40(42)47-35-37(36-48-51(44,45)46)49-41(43)34-30-32-39-38(50-39)31-28-26-24-22-20-16-14-12-10-8-6-4-2/h11-14,17-18,20-23,26,28,37-39H,3-10,15-16,19,24-25,27,29-36H2,1-2H3,(H2,44,45,46)/b13-11-,14-12-,18-17-,22-20-,23-21-,28-26-/t37-,38?,39?/m1/s1 |
| InChIKey | SZXNYIXTFDQAOU-FWYQEHQQSA-N |
| XLogP | 10.50 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.95 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|