C45H73O9P — CID 156969211
[(2R)-1-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate (PubChem CID 156969211) has the molecular formula C45H73O9P and a molecular weight of 789.04 g/mol. Its IUPAC name is [(2R)-1-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate.
| Compound Name | [(2R)-1-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 156969211 |
| Molecular Formula | C45H73O9P |
| Molecular Weight | 789.04 g/mol |
| Exact Mass | 788.50 |
| IUPAC Name | [(2R)-1-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\CC1OC1CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C45H73O9P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-24-27-30-34-38-45(47)53-41(40-52-55(48,49)50)39-51-44(46)37-33-29-26-23-21-20-22-25-28-32-36-43-42(54-43)35-31-6-4-2/h9-10,12-13,15-16,18-20,22-23,26,28,32,41-43H,3-8,11,14,17,21,24-25,27,29-31,33-40H2,1-2H3,(H2,48,49,50)/b10-9-,13-12-,16-15-,19-18-,22-20-,26-23-,32-28-/t41-,42?,43?/m1/s1 |
| InChIKey | BDYBANJCUBALGQ-FMIJESEUSA-N |
| XLogP | 11.83 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.04 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|