C41H69O9P — CID 156968543
[(2R)-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 156968543) has the molecular formula C41H69O9P and a molecular weight of 736.97 g/mol. Its IUPAC name is [(2R)-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156968543 |
| Molecular Formula | C41H69O9P |
| Molecular Weight | 736.97 g/mol |
| Exact Mass | 736.47 |
| IUPAC Name | [(2R)-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCC1OC1C/C=C\CCCCC |
| InChI | InChI=1S/C41H69O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-25-29-33-40(42)47-35-37(36-48-51(44,45)46)49-41(43)34-30-26-22-24-28-32-39-38(50-39)31-27-23-10-8-6-4-2/h11-12,14-15,17-18,20-21,23,27,37-39H,3-10,13,16,19,22,24-26,28-36H2,1-2H3,(H2,44,45,46)/b12-11-,15-14-,18-17-,21-20-,27-23-/t37-,38?,39?/m1/s1 |
| InChIKey | MQPQJIJNJWQTAF-PQAZNLMZSA-N |
| XLogP | 10.72 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.97 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|