C44H77O11P — CID 156972222
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propan-2-yl] (Z)-octadec-11-enoate (PubChem CID 156972222) has the molecular formula C44H77O11P and a molecular weight of 813.06 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propan-2-yl] (Z)-octadec-11-enoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propan-2-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 156972222 |
| Molecular Formula | C44H77O11P |
| Molecular Weight | 813.06 g/mol |
| Exact Mass | 812.52 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propan-2-yl] (Z)-octadec-11-enoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC1OC1CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C44H77O11P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-33-44(48)54-40(38-53-56(49,50)52-36-39(46)35-45)37-51-43(47)34-30-32-42-41(55-42)31-28-26-24-22-20-16-14-12-10-8-6-4-2/h12-15,20,22,26,28,39-42,45-46H,3-11,16-19,21,23-25,27,29-38H2,1-2H3,(H,49,50)/b14-12-,15-13-,22-20-,28-26-/t39-,40+,41?,42?/m0/s1 |
| InChIKey | FYCKXEBLFOQSQE-GOKHUUNKSA-N |
| XLogP | 10.32 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.06 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|