C46H81O11P — CID 156972844
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropan-2-yl] (Z)-icos-11-enoate (PubChem CID 156972844) has the molecular formula C46H81O11P and a molecular weight of 841.12 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 156972844 |
| Molecular Formula | C46H81O11P |
| Molecular Weight | 841.12 g/mol |
| Exact Mass | 840.55 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropan-2-yl] (Z)-icos-11-enoate |
| SMILES | CCCCC/C=C\C/C=C\CC1OC1C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H81O11P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-32-36-46(50)56-42(40-55-58(51,52)54-38-41(48)37-47)39-53-45(49)35-31-28-27-30-34-44-43(57-44)33-29-25-23-21-12-10-8-6-4-2/h12,15-16,21,25,27,29-30,41-44,47-48H,3-11,13-14,17-20,22-24,26,28,31-40H2,1-2H3,(H,51,52)/b16-15-,21-12-,29-25-,30-27-/t41-,42+,43?,44?/m0/s1 |
| InChIKey | DIZDIPOMPCQBOI-MJHAERRCSA-N |
| XLogP | 11.10 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.12 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|