C42H73O11P — CID 156972694
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 156972694) has the molecular formula C42H73O11P and a molecular weight of 785.01 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 156972694 |
| Molecular Formula | C42H73O11P |
| Molecular Weight | 785.01 g/mol |
| Exact Mass | 784.49 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CC1OC1CCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C42H73O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-21-24-28-32-42(46)52-38(36-51-54(47,48)50-34-37(44)33-43)35-49-41(45)31-27-23-20-18-17-19-22-26-30-40-39(53-40)29-25-6-4-2/h9-10,12-13,15-16,22,26,37-40,43-44H,3-8,11,14,17-21,23-25,27-36H2,1-2H3,(H,47,48)/b10-9-,13-12-,16-15-,26-22-/t37-,38+,39?,40?/m0/s1 |
| InChIKey | AKVWOADBFYJQER-BNUSFXTMSA-N |
| XLogP | 9.54 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.01 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|