C42H71O11P — CID 156972686
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156972686) has the molecular formula C42H71O11P and a molecular weight of 782.99 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156972686 |
| Molecular Formula | C42H71O11P |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.47 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H71O11P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-24-29-33-42(47)53-40(37-52-54(48,49)51-35-39(45)34-43)36-50-41(46)32-28-25-21-23-27-31-38(44)30-26-22-19-10-8-6-4-2/h11-12,14-15,17-19,22,26,30,39-40,43,45H,3-10,13,16,20-21,23-25,27-29,31-37H2,1-2H3,(H,48,49)/b12-11-,15-14-,18-17-,22-19-,30-26+/t39-,40+/m0/s1 |
| InChIKey | IOGVIDBMRUKLOU-RSNHDMOGSA-N |
| XLogP | 9.51 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|