C44H75O11P — CID 156973103
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] (5Z,8Z,11Z)-icosa-5,8,11-trienoate (PubChem CID 156973103) has the molecular formula C44H75O11P and a molecular weight of 811.05 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] (5Z,8Z,11Z)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 156973103 |
| Molecular Formula | C44H75O11P |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.50 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC |
| InChI | InChI=1S/C44H75O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-20-23-26-30-34-43(48)52-38-42(39-54-56(50,51)53-37-41(47)36-45)55-44(49)35-31-27-24-21-18-19-22-25-29-33-40(46)32-28-6-4-2/h12-13,15-16,20,22-23,25,29,33,41-42,45,47H,3-11,14,17-19,21,24,26-28,30-32,34-39H2,1-2H3,(H,50,51)/b13-12-,16-15-,23-20-,25-22-,33-29+/t41-,42+/m0/s1 |
| InChIKey | WNMWJUZGZWLYMK-NNUYGAJSSA-N |
| XLogP | 10.29 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|