C39H67O11P — CID 156974553
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(11-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate (PubChem CID 156974553) has the molecular formula C39H67O11P and a molecular weight of 742.93 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(11-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(11-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156974553 |
| Molecular Formula | C39H67O11P |
| Molecular Weight | 742.93 g/mol |
| Exact Mass | 742.44 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(11-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate |
| SMILES | CCCCCC(=O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C39H67O11P/c1-4-5-20-26-35(41)27-22-17-13-9-7-6-8-10-14-19-24-29-39(44)50-37(33-49-51(45,46)48-31-36(42)30-40)32-47-38(43)28-23-18-15-11-12-16-21-25-34(2)3/h6-7,10,13-14,17,22,27,34,36-37,40,42H,4-5,8-9,11-12,15-16,18-21,23-26,28-33H2,1-3H3,(H,45,46)/b7-6-,14-10-,17-13-,27-22+/t36-,37+/m0/s1 |
| InChIKey | HKCJHOQQACTVMV-WDXSSHMCSA-N |
| XLogP | 8.42 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.93 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|